C17H19F13O3 — CID 21063600
[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-fluoro-2-methylbutanoate (PubChem CID 21063600) has the molecular formula C17H19F13O3 and a molecular weight of 518.31 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-fluoro-2-methylbutanoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-fluoro-2-methylbutanoate |
|---|---|
| PubChem CID | 21063600 |
| Molecular Formula | C17H19F13O3 |
| Molecular Weight | 518.31 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-fluoro-2-methylbutanoate |
| SMILES | CCC(C)(F)C(=O)OC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H19F13O3/c1-3-11(2,18)10(31)33-13(16(25,26)27,17(28,29)30)9-6-4-8(5-7-9)12(32,14(19,20)21)15(22,23)24/h8-9,32H,3-7H2,1-2H3 |
| InChIKey | LHEAPXKLPVZLQA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.31 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |