About 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol
3-(1,3-dioxolan-2-yl)-2,4-difluorophenol (PubChem CID 21063809) has the molecular formula C9H8F2O3
and a molecular weight of 202.16 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol.
Molecular Properties
| Compound Name | 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol |
| PubChem CID | 21063809 |
| Molecular Formula | C9H8F2O3 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol |
| SMILES | Oc1ccc(F)c(C2OCCO2)c1F |
| InChI | InChI=1S/C9H8F2O3/c10-5-1-2-6(12)8(11)7(5)9-13-3-4-14-9/h1-2,9,12H,3-4H2 |
| InChIKey | IKRLLJALUBDUHQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol?
The IUPAC name of 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol (CID 21063809) is 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol.
What is the SMILES notation for 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol?
The canonical SMILES for 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol is Oc1ccc(F)c(C2OCCO2)c1F.
What is the InChIKey of 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol?
The InChIKey is IKRLLJALUBDUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O3/c10-5-1-2-6(12)8(11)7(5)9-13-3-4-14-9/h1-2,9,12H,3-4H2.
What are the key properties of 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol?
3-(1,3-dioxolan-2-yl)-2,4-difluorophenol has a molecular weight of 202.16 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxolan-2-yl)-2,4-difluorophenol is sourced from PubChem (CID 21063809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).