C21H23N5O — CID 21064011
3-(1-pyridin-2-ylpiperidin-4-yl)-8-oxa-2,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,11,13-pentaene (PubChem CID 21064011) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 3-(1-pyridin-2-ylpiperidin-4-yl)-8-oxa-2,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,11,13-pentaene.
| Compound Name | 3-(1-pyridin-2-ylpiperidin-4-yl)-8-oxa-2,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,11,13-pentaene |
|---|---|
| PubChem CID | 21064011 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 3-(1-pyridin-2-ylpiperidin-4-yl)-8-oxa-2,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,11,13-pentaene |
| SMILES | c1ccc(N2CCC(c3nnc4n3-c3ccccc3CCOC4)CC2)nc1 |
| InChI | InChI=1S/C21H23N5O/c1-2-6-18-16(5-1)10-14-27-15-20-23-24-21(26(18)20)17-8-12-25(13-9-17)19-7-3-4-11-22-19/h1-7,11,17H,8-10,12-15H2 |
| InChIKey | HMSAFEWWNFOMFR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |