C12H21N3O3 — CID 21064506
4-ethyl-2,3-dioxo-N-pentylpiperazine-1-carboxamide (PubChem CID 21064506) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-ethyl-2,3-dioxo-N-pentylpiperazine-1-carboxamide.
| Compound Name | 4-ethyl-2,3-dioxo-N-pentylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 21064506 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-ethyl-2,3-dioxo-N-pentylpiperazine-1-carboxamide |
| SMILES | CCCCCNC(=O)N1CCN(CC)C(=O)C1=O |
| InChI | InChI=1S/C12H21N3O3/c1-3-5-6-7-13-12(18)15-9-8-14(4-2)10(16)11(15)17/h3-9H2,1-2H3,(H,13,18) |
| InChIKey | IFBDQNGJTFWQTC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|