C19H29N3O3 — CID 21064516
1-but-2-ynyl-3-[cyclohexyl(hydroxy)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 21064516) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-but-2-ynyl-3-[cyclohexyl(hydroxy)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 1-but-2-ynyl-3-[cyclohexyl(hydroxy)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 21064516 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 1-but-2-ynyl-3-[cyclohexyl(hydroxy)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CC#CCN1C(=O)C(C(O)C2CCCCC2)NC(=O)C12CCNCC2 |
| InChI | InChI=1S/C19H29N3O3/c1-2-3-13-22-17(24)15(16(23)14-7-5-4-6-8-14)21-18(25)19(22)9-11-20-12-10-19/h14-16,20,23H,4-13H2,1H3,(H,21,25) |
| InChIKey | LAMODRTVEHODIS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|