C23H32N4O3 — CID 21064601
1-hydroxy-3-[1-[[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,2,4-oxadiazol-5-yl]methyl]cyclohexyl]propan-2-one (PubChem CID 21064601) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-hydroxy-3-[1-[[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,2,4-oxadiazol-5-yl]methyl]cyclohexyl]propan-2-one.
| Compound Name | 1-hydroxy-3-[1-[[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,2,4-oxadiazol-5-yl]methyl]cyclohexyl]propan-2-one |
|---|---|
| PubChem CID | 21064601 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 1-hydroxy-3-[1-[[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,2,4-oxadiazol-5-yl]methyl]cyclohexyl]propan-2-one |
| SMILES | O=C(CO)CC1(Cc2nc(CCCc3ccc4c(n3)NCCC4)no2)CCCCC1 |
| InChI | InChI=1S/C23H32N4O3/c28-16-19(29)14-23(11-2-1-3-12-23)15-21-26-20(27-30-21)8-4-7-18-10-9-17-6-5-13-24-22(17)25-18/h9-10,28H,1-8,11-16H2,(H,24,25) |
| InChIKey | KBWXOYGFYQKLAW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |