C14H24N2O4 — CID 21064628
methyl 4-[3-(5-hydroxypentyl)-1,2,4-oxadiazol-5-yl]-3,3-dimethylbutanoate (PubChem CID 21064628) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is methyl 4-[3-(5-hydroxypentyl)-1,2,4-oxadiazol-5-yl]-3,3-dimethylbutanoate.
| Compound Name | methyl 4-[3-(5-hydroxypentyl)-1,2,4-oxadiazol-5-yl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 21064628 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | methyl 4-[3-(5-hydroxypentyl)-1,2,4-oxadiazol-5-yl]-3,3-dimethylbutanoate |
| SMILES | COC(=O)CC(C)(C)Cc1nc(CCCCCO)no1 |
| InChI | InChI=1S/C14H24N2O4/c1-14(2,10-13(18)19-3)9-12-15-11(16-20-12)7-5-4-6-8-17/h17H,4-10H2,1-3H3 |
| InChIKey | VXIQJXBAPPOKTO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|