C36H38INO4 — CID 21064790
tert-butyl 1-[(3-iodo-4-methylphenyl)methyl]-6,7-bis(phenylmethoxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 21064790) has the molecular formula C36H38INO4 and a molecular weight of 675.61 g/mol. Its IUPAC name is tert-butyl 1-[(3-iodo-4-methylphenyl)methyl]-6,7-bis(phenylmethoxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 1-[(3-iodo-4-methylphenyl)methyl]-6,7-bis(phenylmethoxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 21064790 |
| Molecular Formula | C36H38INO4 |
| Molecular Weight | 675.61 g/mol |
| Exact Mass | 675.18 |
| IUPAC Name | tert-butyl 1-[(3-iodo-4-methylphenyl)methyl]-6,7-bis(phenylmethoxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | Cc1ccc(CC2c3cc(OCc4ccccc4)c(OCc4ccccc4)cc3CCN2C(=O)OC(C)(C)C)cc1I |
| InChI | InChI=1S/C36H38INO4/c1-25-15-16-28(19-31(25)37)20-32-30-22-34(41-24-27-13-9-6-10-14-27)33(40-23-26-11-7-5-8-12-26)21-29(30)17-18-38(32)35(39)42-36(2,3)4/h5-16,19,21-22,32H,17-18,20,23-24H2,1-4H3 |
| InChIKey | ZSPDZVUQFXIMQI-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.61 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|