C17H20ClNO2 — CID 2106515
(1S)-2-[2-(4-chlorophenoxy)ethyl-methylamino]-1-phenylethanol (PubChem CID 2106515) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is (1S)-2-[2-(4-chlorophenoxy)ethyl-methylamino]-1-phenylethanol.
| Compound Name | (1S)-2-[2-(4-chlorophenoxy)ethyl-methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 2106515 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (1S)-2-[2-(4-chlorophenoxy)ethyl-methylamino]-1-phenylethanol |
| SMILES | CN(CCOc1ccc(Cl)cc1)C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H20ClNO2/c1-19(13-17(20)14-5-3-2-4-6-14)11-12-21-16-9-7-15(18)8-10-16/h2-10,17,20H,11-13H2,1H3/t17-/m1/s1 |
| InChIKey | KOFWLPMUYUZEFP-QGZVFWFLSA-N |
| XLogP | 3.38 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |