C18H18N2OSSi — CID 21065237
5-thiophen-2-yl-7-(2-trimethylsilylethynyl)-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 21065237) has the molecular formula C18H18N2OSSi and a molecular weight of 338.51 g/mol. Its IUPAC name is 5-thiophen-2-yl-7-(2-trimethylsilylethynyl)-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 5-thiophen-2-yl-7-(2-trimethylsilylethynyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 21065237 |
| Molecular Formula | C18H18N2OSSi |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 5-thiophen-2-yl-7-(2-trimethylsilylethynyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(c1)C(c1cccs1)=NCC(=O)N2 |
| InChI | InChI=1S/C18H18N2OSSi/c1-23(2,3)10-8-13-6-7-15-14(11-13)18(16-5-4-9-22-16)19-12-17(21)20-15/h4-7,9,11H,12H2,1-3H3,(H,20,21) |
| InChIKey | QAPZICLZATZHDO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|