C22H14F3N3O2 — CID 21065277
2,2,2-trifluoroethyl 8-ethynyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate (PubChem CID 21065277) has the molecular formula C22H14F3N3O2 and a molecular weight of 409.37 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 8-ethynyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 8-ethynyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 21065277 |
| Molecular Formula | C22H14F3N3O2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2,2,2-trifluoroethyl 8-ethynyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| SMILES | C#Cc1ccc2c(c1)C(c1ccccc1)=NCc1c(C(=O)OCC(F)(F)F)ncn1-2 |
| InChI | InChI=1S/C22H14F3N3O2/c1-2-14-8-9-17-16(10-14)19(15-6-4-3-5-7-15)26-11-18-20(27-13-28(17)18)21(29)30-12-22(23,24)25/h1,3-10,13H,11-12H2 |
| InChIKey | JETOHYBAXFEENY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|