C22H13F4N3O2 — CID 21065278
2,2,2-trifluoroethyl 8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate (PubChem CID 21065278) has the molecular formula C22H13F4N3O2 and a molecular weight of 427.36 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 21065278 |
| Molecular Formula | C22H13F4N3O2 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2,2,2-trifluoroethyl 8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| SMILES | C#Cc1ccc2c(c1)C(c1ccccc1F)=NCc1c(C(=O)OCC(F)(F)F)ncn1-2 |
| InChI | InChI=1S/C22H13F4N3O2/c1-2-13-7-8-17-15(9-13)19(14-5-3-4-6-16(14)23)27-10-18-20(28-12-29(17)18)21(30)31-11-22(24,25)26/h1,3-9,12H,10-11H2 |
| InChIKey | KCDQTQWGDLRJLQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|