C26H25N5OSi — CID 21065282
2-[3-(3-ethyl-1,2,4-oxadiazol-5-yl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl-trimethylsilane (PubChem CID 21065282) has the molecular formula C26H25N5OSi and a molecular weight of 451.61 g/mol. Its IUPAC name is 2-[3-(3-ethyl-1,2,4-oxadiazol-5-yl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[3-(3-ethyl-1,2,4-oxadiazol-5-yl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 21065282 |
| Molecular Formula | C26H25N5OSi |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 2-[3-(3-ethyl-1,2,4-oxadiazol-5-yl)-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl-trimethylsilane |
| SMILES | CCc1noc(-c2ncn3c2CN=C(c2ccccc2)c2cc(C#C[Si](C)(C)C)ccc2-3)n1 |
| InChI | InChI=1S/C26H25N5OSi/c1-5-23-29-26(32-30-23)25-22-16-27-24(19-9-7-6-8-10-19)20-15-18(13-14-33(2,3)4)11-12-21(20)31(22)17-28-25/h6-12,15,17H,5,16H2,1-4H3 |
| InChIKey | PAKYWKDENDIXLW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 69.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|