C23H21BrClFN6O — CID 21065406
1-[3-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-3-(2-fluorophenyl)-1-methylurea (PubChem CID 21065406) has the molecular formula C23H21BrClFN6O and a molecular weight of 531.82 g/mol. Its IUPAC name is 1-[3-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-3-(2-fluorophenyl)-1-methylurea.
| Compound Name | 1-[3-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-3-(2-fluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 21065406 |
| Molecular Formula | C23H21BrClFN6O |
| Molecular Weight | 531.82 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 1-[3-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-3-(2-fluorophenyl)-1-methylurea |
| SMILES | CN(CCCNc1cc(-c2ccccc2Cl)nc2c(Br)cnn12)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C23H21BrClFN6O/c1-31(23(33)30-19-10-5-4-9-18(19)26)12-6-11-27-21-13-20(15-7-2-3-8-17(15)25)29-22-16(24)14-28-32(21)22/h2-5,7-10,13-14,27H,6,11-12H2,1H3,(H,30,33) |
| InChIKey | RYUAUDMPSSYEQT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.82 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|