C19H21N3O3 — CID 2106714
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-naphthalen-1-ylacetamide (PubChem CID 2106714) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-naphthalen-1-ylacetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 2106714 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-naphthalen-1-ylacetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)Nc2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C19H21N3O3/c1-3-19(4-2)17(24)22(18(25)21-19)12-16(23)20-15-11-7-9-13-8-5-6-10-14(13)15/h5-11H,3-4,12H2,1-2H3,(H,20,23)(H,21,25) |
| InChIKey | PTVSDKBSPVVVIL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|