About benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate
benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate (PubChem CID 21067271) has the molecular formula C19H19ClN4O2
and a molecular weight of 370.84 g/mol. Its IUPAC name is benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate |
| PubChem CID | 21067271 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCCC1c1cc(Cl)n2nccc2n1 |
| InChI | InChI=1S/C19H19ClN4O2/c20-17-12-15(22-18-9-10-21-24(17)18)16-8-4-5-11-23(16)19(25)26-13-14-6-2-1-3-7-14/h1-3,6-7,9-10,12,16H,4-5,8,11,13H2 |
| InChIKey | LPOVHOORVPQSRC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate?
The IUPAC name of benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate (CID 21067271) is benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate.
What is the SMILES notation for benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate?
The canonical SMILES for benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate is O=C(OCc1ccccc1)N1CCCCC1c1cc(Cl)n2nccc2n1.
What is the InChIKey of benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate?
The InChIKey is LPOVHOORVPQSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN4O2/c20-17-12-15(22-18-9-10-21-24(17)18)16-8-4-5-11-23(16)19(25)26-13-14-6-2-1-3-7-14/h1-3,6-7,9-10,12,16H,4-5,8,11,13H2.
What are the key properties of benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate?
benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate has a molecular weight of 370.84 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate is sourced from PubChem (CID 21067271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).