C24H23BrClN5O4S — CID 21067337
methyl 2-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butylsulfamoyl]benzoate (PubChem CID 21067337) has the molecular formula C24H23BrClN5O4S and a molecular weight of 592.90 g/mol. Its IUPAC name is methyl 2-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butylsulfamoyl]benzoate.
| Compound Name | methyl 2-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 21067337 |
| Molecular Formula | C24H23BrClN5O4S |
| Molecular Weight | 592.90 g/mol |
| Exact Mass | 591.03 |
| IUPAC Name | methyl 2-[4-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]butylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NCCCCNc1cc(-c2ccccc2Cl)nc2c(Br)cnn12 |
| InChI | InChI=1S/C24H23BrClN5O4S/c1-35-24(32)17-9-3-5-11-21(17)36(33,34)29-13-7-6-12-27-22-14-20(16-8-2-4-10-19(16)26)30-23-18(25)15-28-31(22)23/h2-5,8-11,14-15,27,29H,6-7,12-13H2,1H3 |
| InChIKey | GGSRZEXZCSCBNG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|