C21H25BrClN5O2 — CID 21068496
tert-butyl N-[3-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-N-methylcarbamate (PubChem CID 21068496) has the molecular formula C21H25BrClN5O2 and a molecular weight of 494.82 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 21068496 |
| Molecular Formula | C21H25BrClN5O2 |
| Molecular Weight | 494.82 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | tert-butyl N-[3-[[3-bromo-5-(2-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-N-methylcarbamate |
| SMILES | CN(CCCNc1cc(-c2ccccc2Cl)nc2c(Br)cnn12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H25BrClN5O2/c1-21(2,3)30-20(29)27(4)11-7-10-24-18-12-17(14-8-5-6-9-16(14)23)26-19-15(22)13-25-28(18)19/h5-6,8-9,12-13,24H,7,10-11H2,1-4H3 |
| InChIKey | FOCVWQRXOSGTHE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|