C26H32F3N5O6S — CID 21068631
N-hydroxy-1-(pyridine-3-carbonyl)-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonylpiperidine-4-carboxamide (PubChem CID 21068631) has the molecular formula C26H32F3N5O6S and a molecular weight of 599.63 g/mol. Its IUPAC name is N-hydroxy-1-(pyridine-3-carbonyl)-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(pyridine-3-carbonyl)-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 21068631 |
| Molecular Formula | C26H32F3N5O6S |
| Molecular Weight | 599.63 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | N-hydroxy-1-(pyridine-3-carbonyl)-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(c1cccnc1)N1CCC(C(=O)NO)(S(=O)(=O)N2CCN(c3ccc(OCCCC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H32F3N5O6S/c27-26(28,29)8-2-18-40-22-6-4-21(5-7-22)32-14-16-34(17-15-32)41(38,39)25(24(36)31-37)9-12-33(13-10-25)23(35)20-3-1-11-30-19-20/h1,3-7,11,19,37H,2,8-10,12-18H2,(H,31,36) |
| InChIKey | WTGMBJXNFYRRSG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.63 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|