C17H27N2O4SY — CID 21068669
2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;1,2,3-trimethylbenzene-6-ide;yttrium(3+) (PubChem CID 21068669) has the molecular formula C17H27N2O4SY and a molecular weight of 444.39 g/mol. Its IUPAC name is 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;1,2,3-trimethylbenzene-6-ide;yttrium(3+).
| Compound Name | 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;1,2,3-trimethylbenzene-6-ide;yttrium(3+) |
|---|---|
| PubChem CID | 21068669 |
| Molecular Formula | C17H27N2O4SY |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;1,2,3-trimethylbenzene-6-ide;yttrium(3+) |
| SMILES | Cc1[c-]ccc(C)c1C.[CH2-]CN(C[CH2-])S(=O)(=O)C(C)(C)C(=O)NO.[Y+3] |
| InChI | InChI=1S/C9H11.C8H16N2O4S.Y/c1-7-5-4-6-8(2)9(7)3;1-5-10(6-2)15(13,14)8(3,4)7(11)9-12;/h4-5H,1-3H3;12H,1-2,5-6H2,3-4H3,(H,9,11);/q-1;-2;+3 |
| InChIKey | JSWIZMGGKGSOSF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|