About 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+)
2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+) (PubChem CID 21068675) has the molecular formula C11H23N2O4SY
and a molecular weight of 368.29 g/mol. Its IUPAC name is 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+).
Molecular Properties
| Compound Name | 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+) |
| PubChem CID | 21068675 |
| Molecular Formula | C11H23N2O4SY |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+) |
| SMILES | [CH2-]CC.[CH2-]CN(C[CH2-])S(=O)(=O)C(C)(C)C(=O)NO.[Y+3] |
| InChI | InChI=1S/C8H16N2O4S.C3H7.Y/c1-5-10(6-2)15(13,14)8(3,4)7(11)9-12;1-3-2;/h12H,1-2,5-6H2,3-4H3,(H,9,11);1,3H2,2H3;/q-2;-1;+3 |
| InChIKey | QBEVOXDICXWUIJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+)?
The IUPAC name of 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+) (CID 21068675) is 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+).
What is the SMILES notation for 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+)?
The canonical SMILES for 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+) is [CH2-]CC.[CH2-]CN(C[CH2-])S(=O)(=O)C(C)(C)C(=O)NO.[Y+3].
What is the InChIKey of 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+)?
The InChIKey is QBEVOXDICXWUIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O4S.C3H7.Y/c1-5-10(6-2)15(13,14)8(3,4)7(11)9-12;1-3-2;/h12H,1-2,5-6H2,3-4H3,(H,9,11);1,3H2,2H3;/q-2;-1;+3.
What are the key properties of 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+)?
2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+) has a molecular weight of 368.29 g/mol, XLogP of 0.80, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[di(ethyl)sulfamoyl]-N-hydroxy-2-methylpropanamide;propane;yttrium(3+) is sourced from PubChem (CID 21068675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).