C23H32F5N5O6S — CID 21068968
N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 21068968) has the molecular formula C23H32F5N5O6S and a molecular weight of 601.60 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 21068968 |
| Molecular Formula | C23H32F5N5O6S |
| Molecular Weight | 601.60 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)(=O)N2CCN(c3cnc(CCC(F)(F)C(F)(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C23H32F5N5O6S/c24-22(25,23(26,27)28)5-4-17-15-30-18(16-29-17)32-8-10-33(11-9-32)40(35,36)21(6-13-37-14-7-21)20(34)31-39-19-3-1-2-12-38-19/h15-16,19H,1-14H2,(H,31,34) |
| InChIKey | PWKFJZSWZXXJAS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.60 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|