C19H27F3N4O5S — CID 21068981
N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]piperazin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 21068981) has the molecular formula C19H27F3N4O5S and a molecular weight of 480.51 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]piperazin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]piperazin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 21068981 |
| Molecular Formula | C19H27F3N4O5S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]piperazin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCN(c3ccc(CCCC(F)(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C19H27F3N4O5S/c20-19(21,22)5-1-2-15-3-4-16(23-14-15)25-8-10-26(11-9-25)32(29,30)18(17(27)24-28)6-12-31-13-7-18/h3-4,14,28H,1-2,5-13H2,(H,24,27) |
| InChIKey | QKUIFNPGURVPTC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|