C18H26F3N5O5S — CID 21068983
N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 21068983) has the molecular formula C18H26F3N5O5S and a molecular weight of 481.50 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 21068983 |
| Molecular Formula | C18H26F3N5O5S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-hydroxy-4-[4-[5-(4,4,4-trifluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCN(c3cnc(CCCC(F)(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C18H26F3N5O5S/c19-18(20,21)3-1-2-14-12-23-15(13-22-14)25-6-8-26(9-7-25)32(29,30)17(16(27)24-28)4-10-31-11-5-17/h12-13,28H,1-11H2,(H,24,27) |
| InChIKey | FLGQFXRAVSAVGD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|