C18H29F5N2O6S — CID 21069077
N-hydroxy-4-[4-(6,6,7,7,7-pentafluoroheptoxy)piperidin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 21069077) has the molecular formula C18H29F5N2O6S and a molecular weight of 496.50 g/mol. Its IUPAC name is N-hydroxy-4-[4-(6,6,7,7,7-pentafluoroheptoxy)piperidin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-(6,6,7,7,7-pentafluoroheptoxy)piperidin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 21069077 |
| Molecular Formula | C18H29F5N2O6S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-hydroxy-4-[4-(6,6,7,7,7-pentafluoroheptoxy)piperidin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(OCCCCCC(F)(F)C(F)(F)F)CC2)CCOCC1 |
| InChI | InChI=1S/C18H29F5N2O6S/c19-17(20,18(21,22)23)6-2-1-3-11-31-14-4-9-25(10-5-14)32(28,29)16(15(26)24-27)7-12-30-13-8-16/h14,27H,1-13H2,(H,24,26) |
| InChIKey | NNYXECKZFOQSCB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|