C14H26F3N — CID 21069095
4,4-di(propan-2-yl)-1-(3,3,3-trifluoropropyl)piperidine (PubChem CID 21069095) has the molecular formula C14H26F3N and a molecular weight of 265.36 g/mol. Its IUPAC name is 4,4-di(propan-2-yl)-1-(3,3,3-trifluoropropyl)piperidine.
| Compound Name | 4,4-di(propan-2-yl)-1-(3,3,3-trifluoropropyl)piperidine |
|---|---|
| PubChem CID | 21069095 |
| Molecular Formula | C14H26F3N |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 4,4-di(propan-2-yl)-1-(3,3,3-trifluoropropyl)piperidine |
| SMILES | CC(C)C1(C(C)C)CCN(CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H26F3N/c1-11(2)13(12(3)4)5-8-18(9-6-13)10-7-14(15,16)17/h11-12H,5-10H2,1-4H3 |
| InChIKey | APOPGVZNWPZGTO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |