About 4,4-di(propan-2-yl)thiane 1,1-dioxide
4,4-di(propan-2-yl)thiane 1,1-dioxide (PubChem CID 21069099) has the molecular formula C11H22O2S
and a molecular weight of 218.36 g/mol. Its IUPAC name is 4,4-di(propan-2-yl)thiane 1,1-dioxide.
Molecular Properties
| Compound Name | 4,4-di(propan-2-yl)thiane 1,1-dioxide |
| PubChem CID | 21069099 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4,4-di(propan-2-yl)thiane 1,1-dioxide |
| SMILES | CC(C)C1(C(C)C)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H22O2S/c1-9(2)11(10(3)4)5-7-14(12,13)8-6-11/h9-10H,5-8H2,1-4H3 |
| InChIKey | IXYFLINOZYTRAA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-di(propan-2-yl)thiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-di(propan-2-yl)thiane 1,1-dioxide?
The IUPAC name of 4,4-di(propan-2-yl)thiane 1,1-dioxide (CID 21069099) is 4,4-di(propan-2-yl)thiane 1,1-dioxide.
What is the SMILES notation for 4,4-di(propan-2-yl)thiane 1,1-dioxide?
The canonical SMILES for 4,4-di(propan-2-yl)thiane 1,1-dioxide is CC(C)C1(C(C)C)CCS(=O)(=O)CC1.
What is the InChIKey of 4,4-di(propan-2-yl)thiane 1,1-dioxide?
The InChIKey is IXYFLINOZYTRAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2S/c1-9(2)11(10(3)4)5-7-14(12,13)8-6-11/h9-10H,5-8H2,1-4H3.
What are the key properties of 4,4-di(propan-2-yl)thiane 1,1-dioxide?
4,4-di(propan-2-yl)thiane 1,1-dioxide has a molecular weight of 218.36 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-di(propan-2-yl)thiane 1,1-dioxide is sourced from PubChem (CID 21069099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).