About tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate
tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069225) has the molecular formula C23H40F3NO5S
and a molecular weight of 499.64 g/mol. Its IUPAC name is tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
| PubChem CID | 21069225 |
| Molecular Formula | C23H40F3NO5S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCCCCCCC(F)(F)F)CC2)CCOCC1 |
| InChI | InChI=1S/C23H40F3NO5S/c1-21(2,3)32-20(28)22(13-17-31-18-14-22)33(29,30)27-15-10-19(11-16-27)9-7-5-4-6-8-12-23(24,25)26/h19H,4-18H2,1-3H3 |
| InChIKey | UJLOMNLTHCBORJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate?
The IUPAC name of tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate (CID 21069225) is tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate?
The canonical SMILES for tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate is CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCCCCCCC(F)(F)F)CC2)CCOCC1.
What is the InChIKey of tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate?
The InChIKey is UJLOMNLTHCBORJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40F3NO5S/c1-21(2,3)32-20(28)22(13-17-31-18-14-22)33(29,30)27-15-10-19(11-16-27)9-7-5-4-6-8-12-23(24,25)26/h19H,4-18H2,1-3H3.
What are the key properties of tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate?
tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate has a molecular weight of 499.64 g/mol, XLogP of 5.21, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-(8,8,8-trifluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate is sourced from PubChem (CID 21069225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).