C23H38F5NO5S — CID 21069227
tert-butyl 4-[4-(7,7,8,8,8-pentafluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069227) has the molecular formula C23H38F5NO5S and a molecular weight of 535.62 g/mol. Its IUPAC name is tert-butyl 4-[4-(7,7,8,8,8-pentafluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-(7,7,8,8,8-pentafluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 21069227 |
| Molecular Formula | C23H38F5NO5S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | tert-butyl 4-[4-(7,7,8,8,8-pentafluorooctyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCCCCCC(F)(F)C(F)(F)F)CC2)CCOCC1 |
| InChI | InChI=1S/C23H38F5NO5S/c1-20(2,3)34-19(30)21(12-16-33-17-13-21)35(31,32)29-14-9-18(10-15-29)8-6-4-5-7-11-22(24,25)23(26,27)28/h18H,4-17H2,1-3H3 |
| InChIKey | ZYUHCFCIEMQWHF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|