C22H36F5NO5S — CID 21069229
tert-butyl 4-[4-(6,6,7,7,7-pentafluoroheptyl)piperidin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069229) has the molecular formula C22H36F5NO5S and a molecular weight of 521.59 g/mol. Its IUPAC name is tert-butyl 4-[4-(6,6,7,7,7-pentafluoroheptyl)piperidin-1-yl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-(6,6,7,7,7-pentafluoroheptyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 21069229 |
| Molecular Formula | C22H36F5NO5S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | tert-butyl 4-[4-(6,6,7,7,7-pentafluoroheptyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCCCCC(F)(F)C(F)(F)F)CC2)CCOCC1 |
| InChI | InChI=1S/C22H36F5NO5S/c1-19(2,3)33-18(29)20(11-15-32-16-12-20)34(30,31)28-13-8-17(9-14-28)7-5-4-6-10-21(23,24)22(25,26)27/h17H,4-16H2,1-3H3 |
| InChIKey | ZLRFKTCXZIZMNR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|