About tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate
tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069231) has the molecular formula C21H36F3NO5S
and a molecular weight of 471.58 g/mol. Its IUPAC name is tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
| PubChem CID | 21069231 |
| Molecular Formula | C21H36F3NO5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCCCCC(F)(F)F)CC2)CCOCC1 |
| InChI | InChI=1S/C21H36F3NO5S/c1-19(2,3)30-18(26)20(11-15-29-16-12-20)31(27,28)25-13-8-17(9-14-25)7-5-4-6-10-21(22,23)24/h17H,4-16H2,1-3H3 |
| InChIKey | CIMFTYODFXDGOC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate?
The IUPAC name of tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate (CID 21069231) is tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate?
The canonical SMILES for tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate is CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCCCCC(F)(F)F)CC2)CCOCC1.
What is the InChIKey of tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate?
The InChIKey is CIMFTYODFXDGOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36F3NO5S/c1-19(2,3)30-18(26)20(11-15-29-16-12-20)31(27,28)25-13-8-17(9-14-25)7-5-4-6-10-21(22,23)24/h17H,4-16H2,1-3H3.
What are the key properties of tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate?
tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate has a molecular weight of 471.58 g/mol, XLogP of 4.43, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-(6,6,6-trifluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate is sourced from PubChem (CID 21069231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).