C21H34F5NO5S — CID 21069233
tert-butyl 4-[4-(5,5,6,6,6-pentafluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069233) has the molecular formula C21H34F5NO5S and a molecular weight of 507.56 g/mol. Its IUPAC name is tert-butyl 4-[4-(5,5,6,6,6-pentafluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-(5,5,6,6,6-pentafluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 21069233 |
| Molecular Formula | C21H34F5NO5S |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | tert-butyl 4-[4-(5,5,6,6,6-pentafluorohexyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCCCC(F)(F)C(F)(F)F)CC2)CCOCC1 |
| InChI | InChI=1S/C21H34F5NO5S/c1-18(2,3)32-17(28)19(10-14-31-15-11-19)33(29,30)27-12-7-16(8-13-27)6-4-5-9-20(22,23)21(24,25)26/h16H,4-15H2,1-3H3 |
| InChIKey | KAQOSLSIXLIGFY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|