About tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate
tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069241) has the molecular formula C23H40F3NO6S
and a molecular weight of 515.64 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate |
| PubChem CID | 21069241 |
| Molecular Formula | C23H40F3NO6S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCCCOCCCC(F)(F)F)CC2)CCOCC1 |
| InChI | InChI=1S/C23H40F3NO6S/c1-21(2,3)33-20(28)22(11-17-32-18-12-22)34(29,30)27-13-8-19(9-14-27)7-4-5-15-31-16-6-10-23(24,25)26/h19H,4-18H2,1-3H3 |
| InChIKey | JJIRUQTZPCQFSO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate?
The IUPAC name of tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate (CID 21069241) is tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate?
The canonical SMILES for tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate is CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCCCOCCCC(F)(F)F)CC2)CCOCC1.
What is the InChIKey of tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate?
The InChIKey is JJIRUQTZPCQFSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40F3NO6S/c1-21(2,3)33-20(28)22(11-17-32-18-12-22)34(29,30)27-13-8-19(9-14-27)7-4-5-15-31-16-6-10-23(24,25)26/h19H,4-18H2,1-3H3.
What are the key properties of tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate?
tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate has a molecular weight of 515.64 g/mol, XLogP of 4.45, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxylate is sourced from PubChem (CID 21069241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).