C19H31F4NO6S — CID 21069255
tert-butyl 4-[4-(2,2,3,3-tetrafluoropropoxymethyl)piperidin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069255) has the molecular formula C19H31F4NO6S and a molecular weight of 477.52 g/mol. Its IUPAC name is tert-butyl 4-[4-(2,2,3,3-tetrafluoropropoxymethyl)piperidin-1-yl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-(2,2,3,3-tetrafluoropropoxymethyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 21069255 |
| Molecular Formula | C19H31F4NO6S |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | tert-butyl 4-[4-(2,2,3,3-tetrafluoropropoxymethyl)piperidin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(COCC(F)(F)C(F)F)CC2)CCOCC1 |
| InChI | InChI=1S/C19H31F4NO6S/c1-17(2,3)30-16(25)18(6-10-28-11-7-18)31(26,27)24-8-4-14(5-9-24)12-29-13-19(22,23)15(20)21/h14-15H,4-13H2,1-3H3 |
| InChIKey | FDUAHWXYBVQBPG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|