About 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine
1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine (PubChem CID 21069702) has the molecular formula C30H60N2
and a molecular weight of 448.82 g/mol. Its IUPAC name is 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine.
Molecular Properties
| Compound Name | 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine |
| PubChem CID | 21069702 |
| Molecular Formula | C30H60N2 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 448.48 |
| IUPAC Name | 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine |
| SMILES | CCCCCCCC/C=C/NCCCCC(C)CCC(C)N/C=C/CCCCCCCC |
| InChI | InChI=1S/C30H60N2/c1-5-7-9-11-13-15-17-20-26-31-27-22-19-23-29(3)24-25-30(4)32-28-21-18-16-14-12-10-8-6-2/h20-21,26,28-32H,5-19,22-25,27H2,1-4H3/b26-20+,28-21+ |
| InChIKey | UTSYGMGUMSODKP-MYTTYJJWSA-N |
| XLogP | 9.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine?
The IUPAC name of 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine (CID 21069702) is 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine.
What is the SMILES notation for 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine?
The canonical SMILES for 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine is CCCCCCCC/C=C/NCCCCC(C)CCC(C)N/C=C/CCCCCCCC.
What is the InChIKey of 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine?
The InChIKey is UTSYGMGUMSODKP-MYTTYJJWSA-N. The full InChI is InChI=1S/C30H60N2/c1-5-7-9-11-13-15-17-20-26-31-27-22-19-23-29(3)24-25-30(4)32-28-21-18-16-14-12-10-8-6-2/h20-21,26,28-32H,5-19,22-25,27H2,1-4H3/b26-20+,28-21+.
What are the key properties of 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine?
1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine has a molecular weight of 448.82 g/mol, XLogP of 9.67, 25 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,8-N-bis[(E)-dec-1-enyl]-5-methylnonane-1,8-diamine is sourced from PubChem (CID 21069702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).