About 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole
5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole (PubChem CID 21069927) has the molecular formula C8H8BrFN4
and a molecular weight of 259.08 g/mol. Its IUPAC name is 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole.
Molecular Properties
| Compound Name | 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole |
| PubChem CID | 21069927 |
| Molecular Formula | C8H8BrFN4 |
| Molecular Weight | 259.08 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole |
| SMILES | CN1NNN=C1c1cc(F)ccc1Br |
| InChI | InChI=1S/C8H8BrFN4/c1-14-8(11-12-13-14)6-4-5(10)2-3-7(6)9/h2-4,12-13H,1H3 |
| InChIKey | GKJNJLAQSYCBGE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.08 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole?
The IUPAC name of 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole (CID 21069927) is 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole.
What is the SMILES notation for 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole?
The canonical SMILES for 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole is CN1NNN=C1c1cc(F)ccc1Br.
What is the InChIKey of 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole?
The InChIKey is GKJNJLAQSYCBGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrFN4/c1-14-8(11-12-13-14)6-4-5(10)2-3-7(6)9/h2-4,12-13H,1H3.
What are the key properties of 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole?
5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole has a molecular weight of 259.08 g/mol, XLogP of 1.20, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromo-5-fluorophenyl)-1-methyl-2,3-dihydrotetrazole is sourced from PubChem (CID 21069927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).