About (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine
(3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine (PubChem CID 21070906) has the molecular formula C7H6Br2N4
and a molecular weight of 305.96 g/mol. Its IUPAC name is (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine.
Molecular Properties
| Compound Name | (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine |
| PubChem CID | 21070906 |
| Molecular Formula | C7H6Br2N4 |
| Molecular Weight | 305.96 g/mol |
| Exact Mass | 303.90 |
| IUPAC Name | (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine |
| SMILES | NCc1ncc(Br)n2c(Br)cnc12 |
| InChI | InChI=1S/C7H6Br2N4/c8-5-2-11-4(1-10)7-12-3-6(9)13(5)7/h2-3H,1,10H2 |
| InChIKey | SXESCBPDTJPQNY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.96 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine?
The IUPAC name of (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine (CID 21070906) is (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine.
What is the SMILES notation for (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine?
The canonical SMILES for (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine is NCc1ncc(Br)n2c(Br)cnc12.
What is the InChIKey of (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine?
The InChIKey is SXESCBPDTJPQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Br2N4/c8-5-2-11-4(1-10)7-12-3-6(9)13(5)7/h2-3H,1,10H2.
What are the key properties of (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine?
(3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine has a molecular weight of 305.96 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dibromoimidazo[1,2-a]pyrazin-8-yl)methanamine is sourced from PubChem (CID 21070906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).