C9H12N2O — CID 21071182
2-methyl-5,6,7,8-tetrahydro-2,6-naphthyridin-1-one (PubChem CID 21071182) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-methyl-5,6,7,8-tetrahydro-2,6-naphthyridin-1-one.
| Compound Name | 2-methyl-5,6,7,8-tetrahydro-2,6-naphthyridin-1-one |
|---|---|
| PubChem CID | 21071182 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-methyl-5,6,7,8-tetrahydro-2,6-naphthyridin-1-one |
| SMILES | Cn1ccc2c(c1=O)CCNC2 |
| InChI | InChI=1S/C9H12N2O/c1-11-5-3-7-6-10-4-2-8(7)9(11)12/h3,5,10H,2,4,6H2,1H3 |
| InChIKey | WNHXATJDLRWDAM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |