About 1-methoxypropyl hydrogen carbonate
1-methoxypropyl hydrogen carbonate (PubChem CID 21071316) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is 1-methoxypropyl hydrogen carbonate.
Molecular Properties
| Compound Name | 1-methoxypropyl hydrogen carbonate |
| PubChem CID | 21071316 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 1-methoxypropyl hydrogen carbonate |
| SMILES | CCC(OC)OC(=O)O |
| InChI | InChI=1S/C5H10O4/c1-3-4(8-2)9-5(6)7/h4H,3H2,1-2H3,(H,6,7) |
| InChIKey | FHXUGHGXVCDDNG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypropyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropyl hydrogen carbonate?
The IUPAC name of 1-methoxypropyl hydrogen carbonate (CID 21071316) is 1-methoxypropyl hydrogen carbonate.
What is the SMILES notation for 1-methoxypropyl hydrogen carbonate?
The canonical SMILES for 1-methoxypropyl hydrogen carbonate is CCC(OC)OC(=O)O.
What is the InChIKey of 1-methoxypropyl hydrogen carbonate?
The InChIKey is FHXUGHGXVCDDNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4/c1-3-4(8-2)9-5(6)7/h4H,3H2,1-2H3,(H,6,7).
What are the key properties of 1-methoxypropyl hydrogen carbonate?
1-methoxypropyl hydrogen carbonate has a molecular weight of 134.13 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropyl hydrogen carbonate is sourced from PubChem (CID 21071316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).