About [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate
[2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 2107154) has the molecular formula C13H12N2O3S
and a molecular weight of 276.32 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| PubChem CID | 2107154 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | CNC(=O)COC(=O)/C=C/c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H12N2O3S/c1-14-11(16)8-18-13(17)7-6-12-15-9-4-2-3-5-10(9)19-12/h2-7H,8H2,1H3,(H,14,16)/b7-6+ |
| InChIKey | FJAMDZXFCWKQQU-VOTSOKGWSA-N |
| XLogP | 1.60 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate?
The IUPAC name of [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (CID 2107154) is [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
What is the SMILES notation for [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate?
The canonical SMILES for [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate is CNC(=O)COC(=O)/C=C/c1nc2ccccc2s1.
What is the InChIKey of [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate?
The InChIKey is FJAMDZXFCWKQQU-VOTSOKGWSA-N. The full InChI is InChI=1S/C13H12N2O3S/c1-14-11(16)8-18-13(17)7-6-12-15-9-4-2-3-5-10(9)19-12/h2-7H,8H2,1H3,(H,14,16)/b7-6+.
What are the key properties of [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate?
[2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate has a molecular weight of 276.32 g/mol, XLogP of 1.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate is sourced from PubChem (CID 2107154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).