About [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 2107183) has the molecular formula C19H23BrN2O4S
and a molecular weight of 455.37 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate.
Molecular Properties
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
| PubChem CID | 2107183 |
| Molecular Formula | C19H23BrN2O4S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | O=C(COC(=O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C19H23BrN2O4S/c20-19-7-12-4-13(8-19)6-18(5-12,11-19)9-16(24)26-10-15(23)21-22-17(25)14-2-1-3-27-14/h1-3,12-13H,4-11H2,(H,21,23)(H,22,25)/t12-,13+,18?,19? |
| InChIKey | CNGCYKRJEYQLBQ-NFAYLAGKSA-N |
| XLogP | 3.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate?
The IUPAC name of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate (CID 2107183) is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate.
What is the SMILES notation for [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate?
The canonical SMILES for [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate is O=C(COC(=O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)NNC(=O)c1cccs1.
What is the InChIKey of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate?
The InChIKey is CNGCYKRJEYQLBQ-NFAYLAGKSA-N. The full InChI is InChI=1S/C19H23BrN2O4S/c20-19-7-12-4-13(8-19)6-18(5-12,11-19)9-16(24)26-10-15(23)21-22-17(25)14-2-1-3-27-14/h1-3,12-13H,4-11H2,(H,21,23)(H,22,25)/t12-,13+,18?,19?.
What are the key properties of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate?
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate has a molecular weight of 455.37 g/mol, XLogP of 3.18, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate is sourced from PubChem (CID 2107183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).