About [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 2107186) has the molecular formula C21H24BrFN2O4
and a molecular weight of 467.34 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate.
Molecular Properties
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
| PubChem CID | 2107186 |
| Molecular Formula | C21H24BrFN2O4 |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | O=C(COC(=O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C21H24BrFN2O4/c22-21-8-13-5-14(9-21)7-20(6-13,12-21)10-18(27)29-11-17(26)24-25-19(28)15-3-1-2-4-16(15)23/h1-4,13-14H,5-12H2,(H,24,26)(H,25,28)/t13-,14+,20?,21? |
| InChIKey | QNQDKGAKSVZXCR-ZXPDZVFASA-N |
| XLogP | 3.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate?
The IUPAC name of [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate (CID 2107186) is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate.
What is the SMILES notation for [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate?
The canonical SMILES for [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate is O=C(COC(=O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)NNC(=O)c1ccccc1F.
What is the InChIKey of [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate?
The InChIKey is QNQDKGAKSVZXCR-ZXPDZVFASA-N. The full InChI is InChI=1S/C21H24BrFN2O4/c22-21-8-13-5-14(9-21)7-20(6-13,12-21)10-18(27)29-11-17(26)24-25-19(28)15-3-1-2-4-16(15)23/h1-4,13-14H,5-12H2,(H,24,26)(H,25,28)/t13-,14+,20?,21?.
What are the key properties of [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate?
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate has a molecular weight of 467.34 g/mol, XLogP of 3.25, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate is sourced from PubChem (CID 2107186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).