C34H44O5Si2 — CID 21072228
3',6'-bis[[tert-butyl(dimethyl)silyl]oxy]-4',5'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 21072228) has the molecular formula C34H44O5Si2 and a molecular weight of 588.89 g/mol. Its IUPAC name is 3',6'-bis[[tert-butyl(dimethyl)silyl]oxy]-4',5'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis[[tert-butyl(dimethyl)silyl]oxy]-4',5'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 21072228 |
| Molecular Formula | C34H44O5Si2 |
| Molecular Weight | 588.89 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 3',6'-bis[[tert-butyl(dimethyl)silyl]oxy]-4',5'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | Cc1c(O[Si](C)(C)C(C)(C)C)ccc2c1Oc1c(ccc(O[Si](C)(C)C(C)(C)C)c1C)C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C34H44O5Si2/c1-21-27(38-40(9,10)32(3,4)5)19-17-25-29(21)36-30-22(2)28(39-41(11,12)33(6,7)8)20-18-26(30)34(25)24-16-14-13-15-23(24)31(35)37-34/h13-20H,1-12H3 |
| InChIKey | YOQJMXYPCUVYEX-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.89 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|