C9H12F5NO3 — CID 21072483
2,2-dimethyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid (PubChem CID 21072483) has the molecular formula C9H12F5NO3 and a molecular weight of 277.19 g/mol. Its IUPAC name is 2,2-dimethyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid.
| Compound Name | 2,2-dimethyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid |
|---|---|
| PubChem CID | 21072483 |
| Molecular Formula | C9H12F5NO3 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2,2-dimethyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)NCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F5NO3/c1-7(2,6(17)18)5(16)15-4-3-8(10,11)9(12,13)14/h3-4H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | KEFLBCHAXAFJPM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|