About 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid
2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid (PubChem CID 21072496) has the molecular formula C6H8F3NO3
and a molecular weight of 199.13 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid.
Molecular Properties
| Compound Name | 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid |
| PubChem CID | 21072496 |
| Molecular Formula | C6H8F3NO3 |
| Molecular Weight | 199.13 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid |
| SMILES | CC(C(=O)O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H8F3NO3/c1-3(5(12)13)4(11)10-2-6(7,8)9/h3H,2H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | BLZGORVFCANCBP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.13 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid?
The IUPAC name of 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid (CID 21072496) is 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid.
What is the SMILES notation for 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid?
The canonical SMILES for 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid is CC(C(=O)O)C(=O)NCC(F)(F)F.
What is the InChIKey of 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid?
The InChIKey is BLZGORVFCANCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3NO3/c1-3(5(12)13)4(11)10-2-6(7,8)9/h3H,2H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid?
2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid has a molecular weight of 199.13 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid is sourced from PubChem (CID 21072496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).