2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid

C6H8F3NO3 — CID 21072496

IUPAC2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid
SMILESCC(C(=O)O)C(=O)NCC(F)(F)F
InChIInChI=1S/C6H8F3NO3/c1-3(5(12)13)4(11)10-2-6(7,8)9/h3H,2H2,1H3,(H,10,11)(H,12,13)
InChIKeyBLZGORVFCANCBP-UHFFFAOYSA-N
MW199.13 g/mol
LogP0.39
Rot. Bonds3

About 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid

2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid (PubChem CID 21072496) has the molecular formula C6H8F3NO3 and a molecular weight of 199.13 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid.

Molecular Properties

Compound Name2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid
PubChem CID21072496
Molecular FormulaC6H8F3NO3
Molecular Weight199.13 g/mol
Exact Mass199.05
IUPAC Name2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid
SMILESCC(C(=O)O)C(=O)NCC(F)(F)F
InChIInChI=1S/C6H8F3NO3/c1-3(5(12)13)4(11)10-2-6(7,8)9/h3H,2H2,1H3,(H,10,11)(H,12,13)
InChIKeyBLZGORVFCANCBP-UHFFFAOYSA-N
XLogP0.39
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.13
LogP ≤ 50.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid?
The IUPAC name of 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid (CID 21072496) is 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid.
What is the SMILES notation for 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid?
The canonical SMILES for 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid is CC(C(=O)O)C(=O)NCC(F)(F)F.
What is the InChIKey of 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid?
The InChIKey is BLZGORVFCANCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3NO3/c1-3(5(12)13)4(11)10-2-6(7,8)9/h3H,2H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid?
2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid has a molecular weight of 199.13 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-oxo-3-(2,2,2-trifluoroethylamino)propanoic acid is sourced from PubChem (CID 21072496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).