C17H15FN2OS — CID 2107270
3-(1,3-benzothiazol-2-yl)-N-[(2-fluorophenyl)methyl]propanamide (PubChem CID 2107270) has the molecular formula C17H15FN2OS and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-[(2-fluorophenyl)methyl]propanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-[(2-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 2107270 |
| Molecular Formula | C17H15FN2OS |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-[(2-fluorophenyl)methyl]propanamide |
| SMILES | O=C(CCc1nc2ccccc2s1)NCc1ccccc1F |
| InChI | InChI=1S/C17H15FN2OS/c18-13-6-2-1-5-12(13)11-19-16(21)9-10-17-20-14-7-3-4-8-15(14)22-17/h1-8H,9-11H2,(H,19,21) |
| InChIKey | DXUVPBZCLJBWRB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |