C21H23Cl2N5O2 — CID 21073216
2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 21073216) has the molecular formula C21H23Cl2N5O2 and a molecular weight of 448.35 g/mol. Its IUPAC name is 2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 21073216 |
| Molecular Formula | C21H23Cl2N5O2 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 2-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)nc2[nH]1 |
| InChI | InChI=1S/C21H23Cl2N5O2/c22-16-4-3-5-17(19(16)23)28-11-9-27(10-12-28)8-1-2-13-30-21-24-14-15-6-7-18(29)25-20(15)26-21/h3-7,14H,1-2,8-13H2,(H,24,25,26,29) |
| InChIKey | ONWXXZNGMBXUOA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|