About 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one
4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 21073276) has the molecular formula C10H11N3O3S
and a molecular weight of 253.28 g/mol. Its IUPAC name is 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 21073276 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1nc(S(C)(=O)=O)nc2c1ccc(=O)n2C |
| InChI | InChI=1S/C10H11N3O3S/c1-6-7-4-5-8(14)13(2)9(7)12-10(11-6)17(3,15)16/h4-5H,1-3H3 |
| InChIKey | IRVZEDLWKOLXDV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one (CID 21073276) is 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one is Cc1nc(S(C)(=O)=O)nc2c1ccc(=O)n2C.
What is the InChIKey of 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one?
The InChIKey is IRVZEDLWKOLXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O3S/c1-6-7-4-5-8(14)13(2)9(7)12-10(11-6)17(3,15)16/h4-5H,1-3H3.
What are the key properties of 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one?
4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one has a molecular weight of 253.28 g/mol, XLogP of 0.04, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethyl-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 21073276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).