C14H18N2O3 — CID 21073360
4-[(6,6-dimethyl-7-oxo-5,8-dihydro-1,8-naphthyridin-2-yl)oxy]butanal (PubChem CID 21073360) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-[(6,6-dimethyl-7-oxo-5,8-dihydro-1,8-naphthyridin-2-yl)oxy]butanal.
| Compound Name | 4-[(6,6-dimethyl-7-oxo-5,8-dihydro-1,8-naphthyridin-2-yl)oxy]butanal |
|---|---|
| PubChem CID | 21073360 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-[(6,6-dimethyl-7-oxo-5,8-dihydro-1,8-naphthyridin-2-yl)oxy]butanal |
| SMILES | CC1(C)Cc2ccc(OCCCC=O)nc2NC1=O |
| InChI | InChI=1S/C14H18N2O3/c1-14(2)9-10-5-6-11(19-8-4-3-7-17)15-12(10)16-13(14)18/h5-7H,3-4,8-9H2,1-2H3,(H,15,16,18) |
| InChIKey | DLCDCLGLLSZOQT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|