About 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine
4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine (PubChem CID 21073411) has the molecular formula C10H12N4S
and a molecular weight of 220.30 g/mol. Its IUPAC name is 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine |
| PubChem CID | 21073411 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine |
| SMILES | c1cc2sncc2c(N2CCNCC2)n1 |
| InChI | InChI=1S/C10H12N4S/c1-2-12-10(8-7-13-15-9(1)8)14-5-3-11-4-6-14/h1-2,7,11H,3-6H2 |
| InChIKey | YAUHVZVQEUVVQO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine?
The IUPAC name of 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine (CID 21073411) is 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine.
What is the SMILES notation for 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine?
The canonical SMILES for 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine is c1cc2sncc2c(N2CCNCC2)n1.
What is the InChIKey of 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine?
The InChIKey is YAUHVZVQEUVVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4S/c1-2-12-10(8-7-13-15-9(1)8)14-5-3-11-4-6-14/h1-2,7,11H,3-6H2.
What are the key properties of 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine?
4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine has a molecular weight of 220.30 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-yl-[1,2]thiazolo[4,5-c]pyridine is sourced from PubChem (CID 21073411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).